C24H28N2O3 — CID 139477992
3-(4,5-dihydro-1,3-oxazol-2-yl)-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139477992) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-(4,5-dihydro-1,3-oxazol-2-yl)-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 139477992 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)-9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C4=NCCO4)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C24H28N2O3/c1-4-5-18-12-16(2)21(17(3)13-18)22-19(27)14-24(15-20(22)28)6-9-26(10-7-24)23-25-8-11-29-23/h12-13,22H,6-11,14-15H2,1-3H3 |
| InChIKey | RVFHCNIZDFWVKO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|