C22H25NO3 — CID 139477964
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecane-3-carbaldehyde (PubChem CID 139477964) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecane-3-carbaldehyde.
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecane-3-carbaldehyde |
|---|---|
| PubChem CID | 139477964 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-8,10-dioxo-3-azaspiro[5.5]undecane-3-carbaldehyde |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C=O)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C22H25NO3/c1-4-5-17-10-15(2)20(16(3)11-17)21-18(25)12-22(13-19(21)26)6-8-23(14-24)9-7-22/h10-11,14,21H,6-9,12-13H2,1-3H3 |
| InChIKey | GWGBGBZQSNYIQN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|