C24H27NO6 — CID 162502293
2-(1,4-dioxane-2-carbonyl)-7-(2-methoxy-6-methyl-4-prop-1-ynylphenyl)-2-azaspiro[3.5]nonane-6,8-dione (PubChem CID 162502293) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-(1,4-dioxane-2-carbonyl)-7-(2-methoxy-6-methyl-4-prop-1-ynylphenyl)-2-azaspiro[3.5]nonane-6,8-dione.
| Compound Name | 2-(1,4-dioxane-2-carbonyl)-7-(2-methoxy-6-methyl-4-prop-1-ynylphenyl)-2-azaspiro[3.5]nonane-6,8-dione |
|---|---|
| PubChem CID | 162502293 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-(1,4-dioxane-2-carbonyl)-7-(2-methoxy-6-methyl-4-prop-1-ynylphenyl)-2-azaspiro[3.5]nonane-6,8-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CC2=O)CN(C(=O)C2COCCO2)C3)c(OC)c1 |
| InChI | InChI=1S/C24H27NO6/c1-4-5-16-8-15(2)21(19(9-16)29-3)22-17(26)10-24(11-18(22)27)13-25(14-24)23(28)20-12-30-6-7-31-20/h8-9,20,22H,6-7,10-14H2,1-3H3 |
| InChIKey | XOEPYQFCSIDJMA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|