C14H22N2O2S — CID 118549589
1-[(3-ethylphenyl)methyl]-4-methylsulfonylpiperazine (PubChem CID 118549589) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-[(3-ethylphenyl)methyl]-4-methylsulfonylpiperazine.
| Compound Name | 1-[(3-ethylphenyl)methyl]-4-methylsulfonylpiperazine |
|---|---|
| PubChem CID | 118549589 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-[(3-ethylphenyl)methyl]-4-methylsulfonylpiperazine |
| SMILES | CCc1cccc(CN2CCN(S(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C14H22N2O2S/c1-3-13-5-4-6-14(11-13)12-15-7-9-16(10-8-15)19(2,17)18/h4-6,11H,3,7-10,12H2,1-2H3 |
| InChIKey | BFQYKFKGDWMGAD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |