C16H26N2O2S — CID 123477126
1-[(3-ethylphenyl)methyl]-4-propan-2-ylsulfonylpiperazine (PubChem CID 123477126) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 1-[(3-ethylphenyl)methyl]-4-propan-2-ylsulfonylpiperazine.
| Compound Name | 1-[(3-ethylphenyl)methyl]-4-propan-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 123477126 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[(3-ethylphenyl)methyl]-4-propan-2-ylsulfonylpiperazine |
| SMILES | CCc1cccc(CN2CCN(S(=O)(=O)C(C)C)CC2)c1 |
| InChI | InChI=1S/C16H26N2O2S/c1-4-15-6-5-7-16(12-15)13-17-8-10-18(11-9-17)21(19,20)14(2)3/h5-7,12,14H,4,8-11,13H2,1-3H3 |
| InChIKey | DAIXJECKNNLZBJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |