About (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine
(3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine (PubChem CID 145294189) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine |
| PubChem CID | 145294189 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine |
| SMILES | CCc1cccc(CN2C[C@@H](C)[C@@H](C)C2)c1 |
| InChI | InChI=1S/C15H23N/c1-4-14-6-5-7-15(8-14)11-16-9-12(2)13(3)10-16/h5-8,12-13H,4,9-11H2,1-3H3/t12-,13+ |
| InChIKey | CYVWAISVNMJDDG-BETUJISGSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine?
The IUPAC name of (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine (CID 145294189) is (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine.
What is the SMILES notation for (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine?
The canonical SMILES for (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine is CCc1cccc(CN2C[C@@H](C)[C@@H](C)C2)c1.
What is the InChIKey of (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine?
The InChIKey is CYVWAISVNMJDDG-BETUJISGSA-N. The full InChI is InChI=1S/C15H23N/c1-4-14-6-5-7-15(8-14)11-16-9-12(2)13(3)10-16/h5-8,12-13H,4,9-11H2,1-3H3/t12-,13+.
What are the key properties of (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine?
(3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine has a molecular weight of 217.36 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-1-[(3-ethylphenyl)methyl]-3,4-dimethylpyrrolidine is sourced from PubChem (CID 145294189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).