C19H22F3N3O2 — CID 118550959
ethyl 2-[4-[2-piperidin-4-yl-5-(trifluoromethyl)phenyl]pyrazol-1-yl]acetate (PubChem CID 118550959) has the molecular formula C19H22F3N3O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is ethyl 2-[4-[2-piperidin-4-yl-5-(trifluoromethyl)phenyl]pyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[2-piperidin-4-yl-5-(trifluoromethyl)phenyl]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 118550959 |
| Molecular Formula | C19H22F3N3O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | ethyl 2-[4-[2-piperidin-4-yl-5-(trifluoromethyl)phenyl]pyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(-c2cc(C(F)(F)F)ccc2C2CCNCC2)cn1 |
| InChI | InChI=1S/C19H22F3N3O2/c1-2-27-18(26)12-25-11-14(10-24-25)17-9-15(19(20,21)22)3-4-16(17)13-5-7-23-8-6-13/h3-4,9-11,13,23H,2,5-8,12H2,1H3 |
| InChIKey | ZLKFWBQEZKCKTJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |