C18H23F3N2O2 — CID 166174078
2-[2-piperidin-4-yl-4-(trifluoromethyl)phenoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 166174078) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-[2-piperidin-4-yl-4-(trifluoromethyl)phenoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[2-piperidin-4-yl-4-(trifluoromethyl)phenoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 166174078 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[2-piperidin-4-yl-4-(trifluoromethyl)phenoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(COc1ccc(C(F)(F)F)cc1C1CCNCC1)N1CCCC1 |
| InChI | InChI=1S/C18H23F3N2O2/c19-18(20,21)14-3-4-16(15(11-14)13-5-7-22-8-6-13)25-12-17(24)23-9-1-2-10-23/h3-4,11,13,22H,1-2,5-10,12H2 |
| InChIKey | CSCUSMMPDXRPEA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |