C16H19F3O4 — CID 171115863
4-[2-(methoxymethoxy)-5-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid (PubChem CID 171115863) has the molecular formula C16H19F3O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is 4-[2-(methoxymethoxy)-5-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-(methoxymethoxy)-5-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171115863 |
| Molecular Formula | C16H19F3O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-[2-(methoxymethoxy)-5-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid |
| SMILES | COCOc1ccc(C(F)(F)F)cc1C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H19F3O4/c1-22-9-23-14-7-6-12(16(17,18)19)8-13(14)10-2-4-11(5-3-10)15(20)21/h6-8,10-11H,2-5,9H2,1H3,(H,20,21) |
| InChIKey | VVZRPVATZKIBJA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|