C15H16F3NO3 — CID 169212318
methyl 2-[[2-cyclopropyl-4-(trifluoromethyl)benzoyl]-methylamino]acetate (PubChem CID 169212318) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is methyl 2-[[2-cyclopropyl-4-(trifluoromethyl)benzoyl]-methylamino]acetate.
| Compound Name | methyl 2-[[2-cyclopropyl-4-(trifluoromethyl)benzoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 169212318 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl 2-[[2-cyclopropyl-4-(trifluoromethyl)benzoyl]-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)c1ccc(C(F)(F)F)cc1C1CC1 |
| InChI | InChI=1S/C15H16F3NO3/c1-19(8-13(20)22-2)14(21)11-6-5-10(15(16,17)18)7-12(11)9-3-4-9/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | TZFXMQUVQPDPLI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |