C17H24O3 — CID 171115848
4-(5-methyl-2-propoxyphenyl)cyclohexane-1-carboxylic acid (PubChem CID 171115848) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-(5-methyl-2-propoxyphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(5-methyl-2-propoxyphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171115848 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4-(5-methyl-2-propoxyphenyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCOc1ccc(C)cc1C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C17H24O3/c1-3-10-20-16-9-4-12(2)11-15(16)13-5-7-14(8-6-13)17(18)19/h4,9,11,13-14H,3,5-8,10H2,1-2H3,(H,18,19) |
| InChIKey | JDVYTLQRNOIMIR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |