C22H23F6NO3 — CID 154547622
2-[4-[2-(methoxymethoxy)-4-(trifluoromethyl)phenoxy]cycloheptyl]-5-(trifluoromethyl)pyridine (PubChem CID 154547622) has the molecular formula C22H23F6NO3 and a molecular weight of 463.42 g/mol. Its IUPAC name is 2-[4-[2-(methoxymethoxy)-4-(trifluoromethyl)phenoxy]cycloheptyl]-5-(trifluoromethyl)pyridine.
| Compound Name | 2-[4-[2-(methoxymethoxy)-4-(trifluoromethyl)phenoxy]cycloheptyl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 154547622 |
| Molecular Formula | C22H23F6NO3 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[4-[2-(methoxymethoxy)-4-(trifluoromethyl)phenoxy]cycloheptyl]-5-(trifluoromethyl)pyridine |
| SMILES | COCOc1cc(C(F)(F)F)ccc1OC1CCCC(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C22H23F6NO3/c1-30-13-31-20-11-15(21(23,24)25)7-10-19(20)32-17-4-2-3-14(5-8-17)18-9-6-16(12-29-18)22(26,27)28/h6-7,9-12,14,17H,2-5,8,13H2,1H3 |
| InChIKey | DCZYMYQHMOUIDM-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|