C21H23F6N3O2 — CID 154558513
N-[5-(trifluoromethyl)-2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxyphenoxy]propan-1-amine (PubChem CID 154558513) has the molecular formula C21H23F6N3O2 and a molecular weight of 463.42 g/mol. Its IUPAC name is N-[5-(trifluoromethyl)-2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxyphenoxy]propan-1-amine.
| Compound Name | N-[5-(trifluoromethyl)-2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxyphenoxy]propan-1-amine |
|---|---|
| PubChem CID | 154558513 |
| Molecular Formula | C21H23F6N3O2 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[5-(trifluoromethyl)-2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxyphenoxy]propan-1-amine |
| SMILES | CCCNOc1cc(C(F)(F)F)ccc1OC1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C21H23F6N3O2/c1-2-9-29-32-18-12-14(20(22,23)24)3-5-17(18)31-16-7-10-30(11-8-16)19-6-4-15(13-28-19)21(25,26)27/h3-6,12-13,16,29H,2,7-11H2,1H3 |
| InChIKey | GCRZXXMBWQRJIN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|