C23H22F6N2O3 — CID 143115690
(5S,9S)-9-[2-(methoxymethoxy)-4-(trifluoromethyl)phenoxy]-3-[5-(trifluoromethyl)-2-pyridinyl]-3-azabicyclo[3.3.1]non-1(8)-ene (PubChem CID 143115690) has the molecular formula C23H22F6N2O3 and a molecular weight of 488.43 g/mol. Its IUPAC name is (5S,9S)-9-[2-(methoxymethoxy)-4-(trifluoromethyl)phenoxy]-3-[5-(trifluoromethyl)-2-pyridinyl]-3-azabicyclo[3.3.1]non-1(8)-ene.
| Compound Name | (5S,9S)-9-[2-(methoxymethoxy)-4-(trifluoromethyl)phenoxy]-3-[5-(trifluoromethyl)-2-pyridinyl]-3-azabicyclo[3.3.1]non-1(8)-ene |
|---|---|
| PubChem CID | 143115690 |
| Molecular Formula | C23H22F6N2O3 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | (5S,9S)-9-[2-(methoxymethoxy)-4-(trifluoromethyl)phenoxy]-3-[5-(trifluoromethyl)-2-pyridinyl]-3-azabicyclo[3.3.1]non-1(8)-ene |
| SMILES | COCOc1cc(C(F)(F)F)ccc1O[C@@H]1C2=CCC[C@H]1CN(c1ccc(C(F)(F)F)cn1)C2 |
| InChI | InChI=1S/C23H22F6N2O3/c1-32-13-33-19-9-16(22(24,25)26)5-7-18(19)34-21-14-3-2-4-15(21)12-31(11-14)20-8-6-17(10-30-20)23(27,28)29/h3,5-10,15,21H,2,4,11-13H2,1H3/t15-,21+/m0/s1 |
| InChIKey | LOIYCLGRNYDVLC-YCRPNKLZSA-N |
| XLogP | 5.71 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|