C19H26ClNO3 — CID 78889023
2-(4-chloro-2-cyclohexylphenoxy)-1-(3-hydroxypiperidin-1-yl)ethanone (PubChem CID 78889023) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is 2-(4-chloro-2-cyclohexylphenoxy)-1-(3-hydroxypiperidin-1-yl)ethanone.
| Compound Name | 2-(4-chloro-2-cyclohexylphenoxy)-1-(3-hydroxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 78889023 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-(4-chloro-2-cyclohexylphenoxy)-1-(3-hydroxypiperidin-1-yl)ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1C1CCCCC1)N1CCCC(O)C1 |
| InChI | InChI=1S/C19H26ClNO3/c20-15-8-9-18(17(11-15)14-5-2-1-3-6-14)24-13-19(23)21-10-4-7-16(22)12-21/h8-9,11,14,16,22H,1-7,10,12-13H2 |
| InChIKey | JYEUSWLCNYBXST-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |