C17H23ClO3 — CID 43351580
5-(4-chloro-2-cyclohexylphenoxy)pentanoic acid (PubChem CID 43351580) has the molecular formula C17H23ClO3 and a molecular weight of 310.82 g/mol. Its IUPAC name is 5-(4-chloro-2-cyclohexylphenoxy)pentanoic acid.
| Compound Name | 5-(4-chloro-2-cyclohexylphenoxy)pentanoic acid |
|---|---|
| PubChem CID | 43351580 |
| Molecular Formula | C17H23ClO3 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-(4-chloro-2-cyclohexylphenoxy)pentanoic acid |
| SMILES | O=C(O)CCCCOc1ccc(Cl)cc1C1CCCCC1 |
| InChI | InChI=1S/C17H23ClO3/c18-14-9-10-16(21-11-5-4-8-17(19)20)15(12-14)13-6-2-1-3-7-13/h9-10,12-13H,1-8,11H2,(H,19,20) |
| InChIKey | KMVALNJCMWKTSE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|