C14H16Cl2N2O3 — CID 8578422
(3R)-1-[2-(2,5-dichlorophenoxy)acetyl]piperidine-3-carboxamide (PubChem CID 8578422) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is (3R)-1-[2-(2,5-dichlorophenoxy)acetyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-(2,5-dichlorophenoxy)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 8578422 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (3R)-1-[2-(2,5-dichlorophenoxy)acetyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(C(=O)COc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c15-10-3-4-11(16)12(6-10)21-8-13(19)18-5-1-2-9(7-18)14(17)20/h3-4,6,9H,1-2,5,7-8H2,(H2,17,20)/t9-/m1/s1 |
| InChIKey | UOTBPWZTXXDJFE-SECBINFHSA-N |
| XLogP | 2.10 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |