C20H26Cl2N2O3 — CID 55466170
1-[4-(azepane-1-carbonyl)piperidin-1-yl]-2-(2,5-dichlorophenoxy)ethanone (PubChem CID 55466170) has the molecular formula C20H26Cl2N2O3 and a molecular weight of 413.35 g/mol. Its IUPAC name is 1-[4-(azepane-1-carbonyl)piperidin-1-yl]-2-(2,5-dichlorophenoxy)ethanone.
| Compound Name | 1-[4-(azepane-1-carbonyl)piperidin-1-yl]-2-(2,5-dichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 55466170 |
| Molecular Formula | C20H26Cl2N2O3 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-[4-(azepane-1-carbonyl)piperidin-1-yl]-2-(2,5-dichlorophenoxy)ethanone |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)N1CCC(C(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C20H26Cl2N2O3/c21-16-5-6-17(22)18(13-16)27-14-19(25)23-11-7-15(8-12-23)20(26)24-9-3-1-2-4-10-24/h5-6,13,15H,1-4,7-12,14H2 |
| InChIKey | QRCZPKWKIZFTPS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |