C21H26F3NO4 — CID 118551044
tert-butyl 1-[2-[(Z)-3-methoxy-3-oxoprop-1-enyl]-5-(trifluoromethyl)phenyl]piperidine-4-carboxylate (PubChem CID 118551044) has the molecular formula C21H26F3NO4 and a molecular weight of 413.44 g/mol. Its IUPAC name is tert-butyl 1-[2-[(Z)-3-methoxy-3-oxoprop-1-enyl]-5-(trifluoromethyl)phenyl]piperidine-4-carboxylate.
| Compound Name | tert-butyl 1-[2-[(Z)-3-methoxy-3-oxoprop-1-enyl]-5-(trifluoromethyl)phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 118551044 |
| Molecular Formula | C21H26F3NO4 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | tert-butyl 1-[2-[(Z)-3-methoxy-3-oxoprop-1-enyl]-5-(trifluoromethyl)phenyl]piperidine-4-carboxylate |
| SMILES | COC(=O)/C=C\c1ccc(C(F)(F)F)cc1N1CCC(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H26F3NO4/c1-20(2,3)29-19(27)15-9-11-25(12-10-15)17-13-16(21(22,23)24)7-5-14(17)6-8-18(26)28-4/h5-8,13,15H,9-12H2,1-4H3/b8-6- |
| InChIKey | VCZQWPDVXBLRAX-VURMDHGXSA-N |
| XLogP | 4.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|