C9H16FNO2 — CID 118551124
(3R)-1-tert-butyl-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 118551124) has the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. Its IUPAC name is (3R)-1-tert-butyl-3-fluoropyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-tert-butyl-3-fluoropyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 118551124 |
| Molecular Formula | C9H16FNO2 |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (3R)-1-tert-butyl-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)N1CC[C@](F)(C(=O)O)C1 |
| InChI | InChI=1S/C9H16FNO2/c1-8(2,3)11-5-4-9(10,6-11)7(12)13/h4-6H2,1-3H3,(H,12,13)/t9-/m1/s1 |
| InChIKey | HTJRNQRRBYYVGF-SECBINFHSA-N |
| XLogP | 1.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |