C28H17ClN2S — CID 118551559
2-chloro-4-(3,5-diphenylphenyl)-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 118551559) has the molecular formula C28H17ClN2S and a molecular weight of 448.98 g/mol. Its IUPAC name is 2-chloro-4-(3,5-diphenylphenyl)-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 2-chloro-4-(3,5-diphenylphenyl)-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 118551559 |
| Molecular Formula | C28H17ClN2S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 2-chloro-4-(3,5-diphenylphenyl)-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | Clc1nc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2c(n1)sc1ccccc12 |
| InChI | InChI=1S/C28H17ClN2S/c29-28-30-26(25-23-13-7-8-14-24(23)32-27(25)31-28)22-16-20(18-9-3-1-4-10-18)15-21(17-22)19-11-5-2-6-12-19/h1-17H |
| InChIKey | WLQZYOYXZDBIQG-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |