C32H33Cl4N3O3S — CID 11855273
(1R,5S)-N-cyclopropyl-3-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxymethyl]-1,3-thiazol-5-yl]-N-[(2,3-dichlorophenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-2-carboxamide (PubChem CID 11855273) has the molecular formula C32H33Cl4N3O3S and a molecular weight of 681.51 g/mol. Its IUPAC name is (1R,5S)-N-cyclopropyl-3-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxymethyl]-1,3-thiazol-5-yl]-N-[(2,3-dichlorophenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-2-carboxamide.
| Compound Name | (1R,5S)-N-cyclopropyl-3-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxymethyl]-1,3-thiazol-5-yl]-N-[(2,3-dichlorophenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-2-carboxamide |
|---|---|
| PubChem CID | 11855273 |
| Molecular Formula | C32H33Cl4N3O3S |
| Molecular Weight | 681.51 g/mol |
| Exact Mass | 679.10 |
| IUPAC Name | (1R,5S)-N-cyclopropyl-3-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxymethyl]-1,3-thiazol-5-yl]-N-[(2,3-dichlorophenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-2-carboxamide |
| SMILES | Cc1cc(Cl)c(OCCOCc2ncc(C3=C(C(=O)N(Cc4cccc(Cl)c4Cl)C4CC4)[C@H]4CCC[C@@H](C3)N4)s2)c(Cl)c1 |
| InChI | InChI=1S/C32H33Cl4N3O3S/c1-18-12-24(34)31(25(35)13-18)42-11-10-41-17-28-37-15-27(43-28)22-14-20-5-3-7-26(38-20)29(22)32(40)39(21-8-9-21)16-19-4-2-6-23(33)30(19)36/h2,4,6,12-13,15,20-21,26,38H,3,5,7-11,14,16-17H2,1H3/t20-,26+/m0/s1 |
| InChIKey | JUECYMSNPCUTRC-RXFWQSSRSA-N |
| XLogP | 8.52 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.51 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|