C20H27N5O3 — CID 118553840
N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-(2-methoxyethylamino)pyrimidine-4-carboxamide (PubChem CID 118553840) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-(2-methoxyethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-(2-methoxyethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 118553840 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-(2-methoxyethylamino)pyrimidine-4-carboxamide |
| SMILES | COCCNc1cc(C(=O)NC[C@H](O)CN2CCc3ccccc3C2)ncn1 |
| InChI | InChI=1S/C20H27N5O3/c1-28-9-7-21-19-10-18(23-14-24-19)20(27)22-11-17(26)13-25-8-6-15-4-2-3-5-16(15)12-25/h2-5,10,14,17,26H,6-9,11-13H2,1H3,(H,22,27)(H,21,23,24)/t17-/m0/s1 |
| InChIKey | COJWKFGKXKOZEO-KRWDZBQOSA-N |
| XLogP | 0.68 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|