C22H32N6O2 — CID 123195836
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide (PubChem CID 123195836) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 123195836 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-6-[3-(dimethylamino)propylamino]pyrimidine-4-carboxamide |
| SMILES | CN(C)CCCNc1cc(C(=O)NCC(O)CN2CCc3ccccc3C2)ncn1 |
| InChI | InChI=1S/C22H32N6O2/c1-27(2)10-5-9-23-21-12-20(25-16-26-21)22(30)24-13-19(29)15-28-11-8-17-6-3-4-7-18(17)14-28/h3-4,6-7,12,16,19,29H,5,8-11,13-15H2,1-2H3,(H,24,30)(H,23,25,26) |
| InChIKey | XHFUWCOMBNXUQF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|