C25H27FO7S — CID 118554113
(2S,3R,4S,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]-hydroxymethyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (PubChem CID 118554113) has the molecular formula C25H27FO7S and a molecular weight of 490.55 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]-hydroxymethyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]-hydroxymethyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 118554113 |
| Molecular Formula | C25H27FO7S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]-hydroxymethyl]-4-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| SMILES | CO[C@@]1(c2ccc(C)c(C(O)c3ccc(-c4ccc(F)cc4)s3)c2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H27FO7S/c1-13-3-6-15(25(32-2)24(31)23(30)22(29)18(12-27)33-25)11-17(13)21(28)20-10-9-19(34-20)14-4-7-16(26)8-5-14/h3-11,18,21-24,27-31H,12H2,1-2H3/t18-,21?,22-,23+,24-,25+/m1/s1 |
| InChIKey | GDFCVHNKQSYNDB-SCWDAABGSA-N |
| XLogP | 2.22 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |