C25H27FO6S — CID 169440854
(3R,4S,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-2-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (PubChem CID 169440854) has the molecular formula C25H27FO6S and a molecular weight of 474.55 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-2-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-2-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 169440854 |
| Molecular Formula | C25H27FO6S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (3R,4S,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-2-methylphenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| SMILES | COC1(c2cccc(Cc3ccc(-c4ccc(F)cc4)s3)c2C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H27FO6S/c1-14-16(12-18-10-11-21(33-18)15-6-8-17(26)9-7-15)4-3-5-19(14)25(31-2)24(30)23(29)22(28)20(13-27)32-25/h3-11,20,22-24,27-30H,12-13H2,1-2H3/t20-,22-,23+,24-,25?/m1/s1 |
| InChIKey | QGBCBDWVXDAVIL-JUIXOQOVSA-N |
| XLogP | 2.73 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |