C15H19NO4 — CID 11855419
3-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-4-propan-2-yloxycyclobut-3-ene-1,2-dione (PubChem CID 11855419) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-4-propan-2-yloxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-4-propan-2-yloxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11855419 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-4-propan-2-yloxycyclobut-3-ene-1,2-dione |
| SMILES | CC[C@@H](Nc1c(OC(C)C)c(=O)c1=O)c1ccc(C)o1 |
| InChI | InChI=1S/C15H19NO4/c1-5-10(11-7-6-9(4)20-11)16-12-13(17)14(18)15(12)19-8(2)3/h6-8,10,16H,5H2,1-4H3/t10-/m1/s1 |
| InChIKey | UBTAXAIPEHPLSU-SNVBAGLBSA-N |
| XLogP | 2.53 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|