C19H18N2O5 — CID 58736525
3-[[2-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzoic acid (PubChem CID 58736525) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 3-[[2-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzoic acid.
| Compound Name | 3-[[2-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 58736525 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-[[2-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzoic acid |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C(=O)O)c2)c(=O)c1=O)c1ccc(C)o1 |
| InChI | InChI=1S/C19H18N2O5/c1-3-13(14-8-7-10(2)26-14)21-16-15(17(22)18(16)23)20-12-6-4-5-11(9-12)19(24)25/h4-9,13,20-21H,3H2,1-2H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | ZGACDCZCCCCBMH-CYBMUJFWSA-N |
| XLogP | 3.19 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|