C18H25ClN2O2 — CID 118555851
1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)ethanone (PubChem CID 118555851) has the molecular formula C18H25ClN2O2 and a molecular weight of 336.86 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)ethanone.
| Compound Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)ethanone |
|---|---|
| PubChem CID | 118555851 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-chloro-5-methyl-2-propan-2-ylphenoxy)ethanone |
| SMILES | Cc1cc(OCC(=O)N2C[C@H]3CNC[C@H]3C2)c(C(C)C)cc1Cl |
| InChI | InChI=1S/C18H25ClN2O2/c1-11(2)15-5-16(19)12(3)4-17(15)23-10-18(22)21-8-13-6-20-7-14(13)9-21/h4-5,11,13-14,20H,6-10H2,1-3H3/t13-,14+ |
| InChIKey | WRPWVJMNORWLDT-OKILXGFUSA-N |
| XLogP | 2.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |