C22H23NO2 — CID 118556124
2,6-di(cyclohexen-1-yl)quinoline-5-carboxylic acid (PubChem CID 118556124) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2,6-di(cyclohexen-1-yl)quinoline-5-carboxylic acid.
| Compound Name | 2,6-di(cyclohexen-1-yl)quinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 118556124 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2,6-di(cyclohexen-1-yl)quinoline-5-carboxylic acid |
| SMILES | O=C(O)c1c(C2=CCCCC2)ccc2nc(C3=CCCCC3)ccc12 |
| InChI | InChI=1S/C22H23NO2/c24-22(25)21-17(15-7-3-1-4-8-15)11-14-20-18(21)12-13-19(23-20)16-9-5-2-6-10-16/h7,9,11-14H,1-6,8,10H2,(H,24,25) |
| InChIKey | ZFNVBLOYZDYMJV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |