C29H20Cl2F3N3 — CID 11855620
3-(3-benzyl-8-chlorocinnolin-4-yl)-N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 11855620) has the molecular formula C29H20Cl2F3N3 and a molecular weight of 538.40 g/mol. Its IUPAC name is 3-(3-benzyl-8-chlorocinnolin-4-yl)-N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | 3-(3-benzyl-8-chlorocinnolin-4-yl)-N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 11855620 |
| Molecular Formula | C29H20Cl2F3N3 |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | 3-(3-benzyl-8-chlorocinnolin-4-yl)-N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | FC(F)(F)c1cccc(CNc2cccc(-c3c(Cc4ccccc4)nnc4c(Cl)cccc34)c2)c1Cl |
| InChI | InChI=1S/C29H20Cl2F3N3/c30-24-14-6-12-22-26(25(36-37-28(22)24)15-18-7-2-1-3-8-18)19-9-4-11-21(16-19)35-17-20-10-5-13-23(27(20)31)29(32,33)34/h1-14,16,35H,15,17H2 |
| InChIKey | XHUGCOUNHPKMDJ-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |