C28H18Cl2F3N3 — CID 11855894
3-(8-chloro-3-phenylcinnolin-4-yl)-N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 11855894) has the molecular formula C28H18Cl2F3N3 and a molecular weight of 524.37 g/mol. Its IUPAC name is 3-(8-chloro-3-phenylcinnolin-4-yl)-N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | 3-(8-chloro-3-phenylcinnolin-4-yl)-N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 11855894 |
| Molecular Formula | C28H18Cl2F3N3 |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | 3-(8-chloro-3-phenylcinnolin-4-yl)-N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | FC(F)(F)c1cccc(CNc2cccc(-c3c(-c4ccccc4)nnc4c(Cl)cccc34)c2)c1Cl |
| InChI | InChI=1S/C28H18Cl2F3N3/c29-23-14-6-12-21-24(26(35-36-27(21)23)17-7-2-1-3-8-17)18-9-4-11-20(15-18)34-16-19-10-5-13-22(25(19)30)28(31,32)33/h1-15,34H,16H2 |
| InChIKey | JIFCPICGKDCWFQ-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |