C29H24ClN3 — CID 11856162
3-(8-chloro-3-phenylcinnolin-4-yl)-N-[(2,5-dimethylphenyl)methyl]aniline (PubChem CID 11856162) has the molecular formula C29H24ClN3 and a molecular weight of 449.99 g/mol. Its IUPAC name is 3-(8-chloro-3-phenylcinnolin-4-yl)-N-[(2,5-dimethylphenyl)methyl]aniline.
| Compound Name | 3-(8-chloro-3-phenylcinnolin-4-yl)-N-[(2,5-dimethylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 11856162 |
| Molecular Formula | C29H24ClN3 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-(8-chloro-3-phenylcinnolin-4-yl)-N-[(2,5-dimethylphenyl)methyl]aniline |
| SMILES | Cc1ccc(C)c(CNc2cccc(-c3c(-c4ccccc4)nnc4c(Cl)cccc34)c2)c1 |
| InChI | InChI=1S/C29H24ClN3/c1-19-14-15-20(2)23(16-19)18-31-24-11-6-10-22(17-24)27-25-12-7-13-26(30)29(25)33-32-28(27)21-8-4-3-5-9-21/h3-17,31H,18H2,1-2H3 |
| InChIKey | JBJNMNYZQOGUTE-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |