C16H10Cl2F3N3O — CID 67416695
4-chloro-6-[[2-chloro-3-(trifluoromethyl)phenyl]methylamino]-2H-phthalazin-1-one (PubChem CID 67416695) has the molecular formula C16H10Cl2F3N3O and a molecular weight of 388.18 g/mol. Its IUPAC name is 4-chloro-6-[[2-chloro-3-(trifluoromethyl)phenyl]methylamino]-2H-phthalazin-1-one.
| Compound Name | 4-chloro-6-[[2-chloro-3-(trifluoromethyl)phenyl]methylamino]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 67416695 |
| Molecular Formula | C16H10Cl2F3N3O |
| Molecular Weight | 388.18 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 4-chloro-6-[[2-chloro-3-(trifluoromethyl)phenyl]methylamino]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cl)c2cc(NCc3cccc(C(F)(F)F)c3Cl)ccc12 |
| InChI | InChI=1S/C16H10Cl2F3N3O/c17-13-8(2-1-3-12(13)16(19,20)21)7-22-9-4-5-10-11(6-9)14(18)23-24-15(10)25/h1-6,22H,7H2,(H,24,25) |
| InChIKey | UPWRPRZIGOZTRN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.18 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |