C20H19ClF3N5O — CID 59743135
4-chloro-6-[[2-piperazin-1-yl-5-(trifluoromethyl)phenyl]methylamino]-2H-phthalazin-1-one (PubChem CID 59743135) has the molecular formula C20H19ClF3N5O and a molecular weight of 437.85 g/mol. Its IUPAC name is 4-chloro-6-[[2-piperazin-1-yl-5-(trifluoromethyl)phenyl]methylamino]-2H-phthalazin-1-one.
| Compound Name | 4-chloro-6-[[2-piperazin-1-yl-5-(trifluoromethyl)phenyl]methylamino]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 59743135 |
| Molecular Formula | C20H19ClF3N5O |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 4-chloro-6-[[2-piperazin-1-yl-5-(trifluoromethyl)phenyl]methylamino]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cl)c2cc(NCc3cc(C(F)(F)F)ccc3N3CCNCC3)ccc12 |
| InChI | InChI=1S/C20H19ClF3N5O/c21-18-16-10-14(2-3-15(16)19(30)28-27-18)26-11-12-9-13(20(22,23)24)1-4-17(12)29-7-5-25-6-8-29/h1-4,9-10,25-26H,5-8,11H2,(H,28,30) |
| InChIKey | VHQXYWJRDLDTNF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |