C14H18F3N3O — CID 175997049
3-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]propanal (PubChem CID 175997049) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 3-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]propanal.
| Compound Name | 3-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]propanal |
|---|---|
| PubChem CID | 175997049 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-[4-piperazin-1-yl-3-(trifluoromethyl)anilino]propanal |
| SMILES | O=CCCNc1ccc(N2CCNCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3N3O/c15-14(16,17)12-10-11(19-4-1-9-21)2-3-13(12)20-7-5-18-6-8-20/h2-3,9-10,18-19H,1,4-8H2 |
| InChIKey | WVVDYWSPWQTEFQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|