C16H11ClF3N3O2 — CID 58447211
4-chloro-6-[[3-(trifluoromethoxy)phenyl]methylamino]-2H-phthalazin-1-one (PubChem CID 58447211) has the molecular formula C16H11ClF3N3O2 and a molecular weight of 369.73 g/mol. Its IUPAC name is 4-chloro-6-[[3-(trifluoromethoxy)phenyl]methylamino]-2H-phthalazin-1-one.
| Compound Name | 4-chloro-6-[[3-(trifluoromethoxy)phenyl]methylamino]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 58447211 |
| Molecular Formula | C16H11ClF3N3O2 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 4-chloro-6-[[3-(trifluoromethoxy)phenyl]methylamino]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cl)c2cc(NCc3cccc(OC(F)(F)F)c3)ccc12 |
| InChI | InChI=1S/C16H11ClF3N3O2/c17-14-13-7-10(4-5-12(13)15(24)23-22-14)21-8-9-2-1-3-11(6-9)25-16(18,19)20/h1-7,21H,8H2,(H,23,24) |
| InChIKey | XLWBDKDAXGKDDQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |