About 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one
4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one (PubChem CID 59743147) has the molecular formula C20H22ClN5O
and a molecular weight of 383.88 g/mol. Its IUPAC name is 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one.
Molecular Properties
| Compound Name | 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one |
| PubChem CID | 59743147 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cl)c2cc(NCc3ccccc3N3CCCNCC3)ccc12 |
| InChI | InChI=1S/C20H22ClN5O/c21-19-17-12-15(6-7-16(17)20(27)25-24-19)23-13-14-4-1-2-5-18(14)26-10-3-8-22-9-11-26/h1-2,4-7,12,22-23H,3,8-11,13H2,(H,25,27) |
| InChIKey | BJWODKCZDYSCMM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one?
The IUPAC name of 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one (CID 59743147) is 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one.
What is the SMILES notation for 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one?
The canonical SMILES for 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one is O=c1[nH]nc(Cl)c2cc(NCc3ccccc3N3CCCNCC3)ccc12.
What is the InChIKey of 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one?
The InChIKey is BJWODKCZDYSCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClN5O/c21-19-17-12-15(6-7-16(17)20(27)25-24-19)23-13-14-4-1-2-5-18(14)26-10-3-8-22-9-11-26/h1-2,4-7,12,22-23H,3,8-11,13H2,(H,25,27).
What are the key properties of 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one?
4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one has a molecular weight of 383.88 g/mol, XLogP of 2.99, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-[[2-(1,4-diazepan-1-yl)phenyl]methylamino]-2H-phthalazin-1-one is sourced from PubChem (CID 59743147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).