C17H20ClN3 — CID 133439763
2-chloro-N-[(2-piperidin-1-ylphenyl)methyl]pyridin-4-amine (PubChem CID 133439763) has the molecular formula C17H20ClN3 and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-chloro-N-[(2-piperidin-1-ylphenyl)methyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[(2-piperidin-1-ylphenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133439763 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-chloro-N-[(2-piperidin-1-ylphenyl)methyl]pyridin-4-amine |
| SMILES | Clc1cc(NCc2ccccc2N2CCCCC2)ccn1 |
| InChI | InChI=1S/C17H20ClN3/c18-17-12-15(8-9-19-17)20-13-14-6-2-3-7-16(14)21-10-4-1-5-11-21/h2-3,6-9,12H,1,4-5,10-11,13H2,(H,19,20) |
| InChIKey | MYEGILPRHIRJOE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|