C16H20ClN3O2S — CID 133360241
N-tert-butyl-2-[[(2-chloro-4-pyridinyl)amino]methyl]benzenesulfonamide (PubChem CID 133360241) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is N-tert-butyl-2-[[(2-chloro-4-pyridinyl)amino]methyl]benzenesulfonamide.
| Compound Name | N-tert-butyl-2-[[(2-chloro-4-pyridinyl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 133360241 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-tert-butyl-2-[[(2-chloro-4-pyridinyl)amino]methyl]benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1CNc1ccnc(Cl)c1 |
| InChI | InChI=1S/C16H20ClN3O2S/c1-16(2,3)20-23(21,22)14-7-5-4-6-12(14)11-19-13-8-9-18-15(17)10-13/h4-10,20H,11H2,1-3H3,(H,18,19) |
| InChIKey | VQMGDBJWOUBVGD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|