C18H23ClN2O2S — CID 48563112
N-tert-butyl-2-[[(3-chlorophenyl)methylamino]methyl]benzenesulfonamide (PubChem CID 48563112) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is N-tert-butyl-2-[[(3-chlorophenyl)methylamino]methyl]benzenesulfonamide.
| Compound Name | N-tert-butyl-2-[[(3-chlorophenyl)methylamino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 48563112 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-tert-butyl-2-[[(3-chlorophenyl)methylamino]methyl]benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1CNCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H23ClN2O2S/c1-18(2,3)21-24(22,23)17-10-5-4-8-15(17)13-20-12-14-7-6-9-16(19)11-14/h4-11,20-21H,12-13H2,1-3H3 |
| InChIKey | HHUOWOBSXNQRAE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |