C14H25NO2SSn — CID 13372366
N-tert-butyl-2-(trimethylstannylmethyl)benzenesulfonamide (PubChem CID 13372366) has the molecular formula C14H25NO2SSn and a molecular weight of 390.14 g/mol. Its IUPAC name is N-tert-butyl-2-(trimethylstannylmethyl)benzenesulfonamide.
| Compound Name | N-tert-butyl-2-(trimethylstannylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 13372366 |
| Molecular Formula | C14H25NO2SSn |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | N-tert-butyl-2-(trimethylstannylmethyl)benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1C[Sn](C)(C)C |
| InChI | InChI=1S/C11H16NO2S.3CH3.Sn/c1-9-7-5-6-8-10(9)15(13,14)12-11(2,3)4;;;;/h5-8,12H,1H2,2-4H3;3*1H3; |
| InChIKey | GDLXDMDUOHTJBK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |