About N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide
N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide (PubChem CID 133468803) has the molecular formula C17H24N4O2S
and a molecular weight of 348.47 g/mol. Its IUPAC name is N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide |
| PubChem CID | 133468803 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide |
| SMILES | Cc1cnc(C)c(NCc2ccccc2S(=O)(=O)NC(C)(C)C)n1 |
| InChI | InChI=1S/C17H24N4O2S/c1-12-10-18-13(2)16(20-12)19-11-14-8-6-7-9-15(14)24(22,23)21-17(3,4)5/h6-10,21H,11H2,1-5H3,(H,19,20) |
| InChIKey | PSFABBRUMJEGJE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide?
The IUPAC name of N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide (CID 133468803) is N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide.
What is the SMILES notation for N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide?
The canonical SMILES for N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide is Cc1cnc(C)c(NCc2ccccc2S(=O)(=O)NC(C)(C)C)n1.
What is the InChIKey of N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide?
The InChIKey is PSFABBRUMJEGJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O2S/c1-12-10-18-13(2)16(20-12)19-11-14-8-6-7-9-15(14)24(22,23)21-17(3,4)5/h6-10,21H,11H2,1-5H3,(H,19,20).
What are the key properties of N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide?
N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide has a molecular weight of 348.47 g/mol, XLogP of 2.78, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]benzenesulfonamide is sourced from PubChem (CID 133468803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).