C16H17ClFN3O — CID 133359820
2-chloro-N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]pyridin-4-amine (PubChem CID 133359820) has the molecular formula C16H17ClFN3O and a molecular weight of 321.78 g/mol. Its IUPAC name is 2-chloro-N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133359820 |
| Molecular Formula | C16H17ClFN3O |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-chloro-N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]pyridin-4-amine |
| SMILES | Fc1cc(CNc2ccnc(Cl)c2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C16H17ClFN3O/c17-16-10-13(3-4-19-16)20-11-12-1-2-15(14(18)9-12)21-5-7-22-8-6-21/h1-4,9-10H,5-8,11H2,(H,19,20) |
| InChIKey | GNAJWGCROPZMDQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|