C20H23ClN4O2 — CID 39860577
5-[(3-chloro-4-morpholin-4-ylanilino)methyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 39860577) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is 5-[(3-chloro-4-morpholin-4-ylanilino)methyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[(3-chloro-4-morpholin-4-ylanilino)methyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 39860577 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 5-[(3-chloro-4-morpholin-4-ylanilino)methyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(CNc3ccc(N4CCOCC4)c(Cl)c3)ccc21 |
| InChI | InChI=1S/C20H23ClN4O2/c1-23-18-5-3-14(11-19(18)24(2)20(23)26)13-22-15-4-6-17(16(21)12-15)25-7-9-27-10-8-25/h3-6,11-12,22H,7-10,13H2,1-2H3 |
| InChIKey | XCYYSPGKVXZJDV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|