C19H25FN4O2 — CID 128976408
(2S,3S)-N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-(1-methylimidazol-2-yl)oxolan-3-amine (PubChem CID 128976408) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is (2S,3S)-N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-(1-methylimidazol-2-yl)oxolan-3-amine.
| Compound Name | (2S,3S)-N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-(1-methylimidazol-2-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 128976408 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (2S,3S)-N-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-(1-methylimidazol-2-yl)oxolan-3-amine |
| SMILES | Cn1ccnc1[C@H]1OCC[C@@H]1NCc1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C19H25FN4O2/c1-23-6-5-21-19(23)18-16(4-9-26-18)22-13-14-2-3-17(15(20)12-14)24-7-10-25-11-8-24/h2-3,5-6,12,16,18,22H,4,7-11,13H2,1H3/t16-,18-/m0/s1 |
| InChIKey | QSXSYTDDHIHWTO-WMZOPIPTSA-N |
| XLogP | 2.02 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|