C17H19ClN4O2 — CID 167918382
4-[(5-chloro-2-morpholin-4-ylphenyl)methylamino]pyridine-2-carboxamide (PubChem CID 167918382) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 4-[(5-chloro-2-morpholin-4-ylphenyl)methylamino]pyridine-2-carboxamide.
| Compound Name | 4-[(5-chloro-2-morpholin-4-ylphenyl)methylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167918382 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-[(5-chloro-2-morpholin-4-ylphenyl)methylamino]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(NCc2cc(Cl)ccc2N2CCOCC2)ccn1 |
| InChI | InChI=1S/C17H19ClN4O2/c18-13-1-2-16(22-5-7-24-8-6-22)12(9-13)11-21-14-3-4-20-15(10-14)17(19)23/h1-4,9-10H,5-8,11H2,(H2,19,23)(H,20,21) |
| InChIKey | VPSZAVLPTQNIIM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |