C15H22ClIN4O — CID 120972680
N-[(5-chloro-2-morpholin-4-ylphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120972680) has the molecular formula C15H22ClIN4O and a molecular weight of 436.73 g/mol. Its IUPAC name is N-[(5-chloro-2-morpholin-4-ylphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-[(5-chloro-2-morpholin-4-ylphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120972680 |
| Molecular Formula | C15H22ClIN4O |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-[(5-chloro-2-morpholin-4-ylphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1NCc1cc(Cl)ccc1N1CCOCC1.I |
| InChI | InChI=1S/C15H21ClN4O.HI/c1-19-5-4-17-15(19)18-11-12-10-13(16)2-3-14(12)20-6-8-21-9-7-20;/h2-3,10H,4-9,11H2,1H3,(H,17,18);1H |
| InChIKey | LGCWPYOOHWAMNK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|