C30H37ClN6O3 — CID 118558664
8-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-6-[3-chloro-5-(2-methoxyethoxy)phenyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carbonitrile (PubChem CID 118558664) has the molecular formula C30H37ClN6O3 and a molecular weight of 565.12 g/mol. Its IUPAC name is 8-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-6-[3-chloro-5-(2-methoxyethoxy)phenyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carbonitrile.
| Compound Name | 8-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-6-[3-chloro-5-(2-methoxyethoxy)phenyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carbonitrile |
|---|---|
| PubChem CID | 118558664 |
| Molecular Formula | C30H37ClN6O3 |
| Molecular Weight | 565.12 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 8-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-6-[3-chloro-5-(2-methoxyethoxy)phenyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carbonitrile |
| SMILES | COCCOc1cc(Cl)cc(-c2nc(C#N)nc3nc(N4CCO[C@@H]5CCC[C@H]54)n(CC4CCC(C)CC4)c23)c1 |
| InChI | InChI=1S/C30H37ClN6O3/c1-19-6-8-20(9-7-19)18-37-28-27(21-14-22(31)16-23(15-21)39-13-12-38-2)33-26(17-32)34-29(28)35-30(37)36-10-11-40-25-5-3-4-24(25)36/h14-16,19-20,24-25H,3-13,18H2,1-2H3/t19?,20?,24-,25-/m1/s1 |
| InChIKey | WYNOXERQJQNODT-LTBUFCQKSA-N |
| XLogP | 5.63 |
| TPSA | 98.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.12 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|