C28H32ClN7O3 — CID 136632401
3-[8-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136632401) has the molecular formula C28H32ClN7O3 and a molecular weight of 550.06 g/mol. Its IUPAC name is 3-[8-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[8-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 136632401 |
| Molecular Formula | C28H32ClN7O3 |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 3-[8-[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | CC1CCC(Cn2c(N3CCO[C@@H]4CCC[C@H]43)nc3nc(-c4noc(=O)[nH]4)nc(-c4cccc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C28H32ClN7O3/c1-16-8-10-17(11-9-16)15-36-23-22(18-4-2-5-19(29)14-18)30-25(26-33-28(37)39-34-26)31-24(23)32-27(36)35-12-13-38-21-7-3-6-20(21)35/h2,4-5,14,16-17,20-21H,3,6-13,15H2,1H3,(H,33,34,37)/t16?,17?,20-,21-/m1/s1 |
| InChIKey | HOKOGWNCJVPJIB-XRUXWCASSA-N |
| XLogP | 5.07 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |